3-Methylcholanthrene - dangerous good and controlled substance, CAS [[56-49-5]]
Catalog Number:
CBS-FM25802
| Article Name: |
3-Methylcholanthrene - dangerous good and controlled substance, CAS [[56-49-5]] |
| Biozol Catalog Number: |
CBS-FM25802 |
| Supplier Catalog Number: |
FM25802 |
| Alternative Catalog Number: |
CBS-FM25802-10MG, CBS-FM25802-25MG, CBS-FM25802-50MG, CBS-FM25802-100MG, CBS-FM25802-250MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
1,2-Dihydro-3-methyl-benz[j]aceanthrylene,20-Methylcholanthrene,3-MC |
| Molecular Weight: |
268.35 g/mol |
| Sequence: |
CC1=C2CCC3=C2C(=CC4=C3C=CC5=CC=CC=C54)C=C1 |
| CAS Number: |
[56-49-5] |
| Formula: |
C21H16 |