Methylergonovine maleate salt - dangerous good and controlled substance, CAS [[57432-61-8]]
Catalog Number:
CBS-FM25836
| Article Name: |
Methylergonovine maleate salt - dangerous good and controlled substance, CAS [[57432-61-8]] |
| Biozol Catalog Number: |
CBS-FM25836 |
| Supplier Catalog Number: |
FM25836 |
| Alternative Catalog Number: |
CBS-FM25836-0.005G,CBS-FM25836-0.01G,CBS-FM25836-0.025G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
(8b)-9,10-Didehydro-N-[(1S)-1-(hydroxymethyl)propyl]-6-methyl-ergoline-8-carbox-amide maleate,N-[a-(Hydroxymethyl)propyl]-D-lyse |
| Molecular Weight: |
455.5 g/mol |
| Sequence: |
CCC(CO)NC(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C.C(=CC(=O)O)C(=O)O |
| CAS Number: |
[57432-61-8] |
| Formula: |
C24H29N3O6 |