N-Methyl-4-nitroaniline - dangerous good and controlled substance, CAS [[100-15-2]]
Catalog Number:
CBS-FM76174
| Article Name: |
N-Methyl-4-nitroaniline - dangerous good and controlled substance, CAS [[100-15-2]] |
| Biozol Catalog Number: |
CBS-FM76174 |
| Supplier Catalog Number: |
FM76174 |
| Alternative Catalog Number: |
CBS-FM76174-25G, CBS-FM76174-50G, CBS-FM76174-100G, CBS-FM76174-250G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
4-Nitro-N-methylaniline |
| Molecular Weight: |
152.15 g/mol |
| Sequence: |
CNC1=CC=C(C=C1)[N+](=O)[O-] |
| CAS Number: |
[100-15-2] |
| Formula: |
C7H8N2O2 |