Phenylacetic acid isopentyl ester - dangerous good and controlled substance, CAS [[102-19-2]]
Catalog Number:
CBS-FP55055
| Article Name: |
Phenylacetic acid isopentyl ester - dangerous good and controlled substance, CAS [[102-19-2]] |
| Biozol Catalog Number: |
CBS-FP55055 |
| Supplier Catalog Number: |
FP55055 |
| Alternative Catalog Number: |
CBS-FP55055-0.1KG, CBS-FP55055-0.25KG, CBS-FP55055-0.5KG, CBS-FP55055-1KG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
Phenylacetic acid isoamyl ester |
| Molecular Weight: |
206.28 g/mol |
| Sequence: |
CC(C)CCOC(=O)CC1=CC=CC=C1 |
| CAS Number: |
[102-19-2] |
| Formula: |
C13H18O2 |