N-Phenyl-2-naphthylamine - dangerous good and controlled substance, CAS [[135-88-6]]
Catalog Number:
CBS-FP62307
| Article Name: |
N-Phenyl-2-naphthylamine - dangerous good and controlled substance, CAS [[135-88-6]] |
| Biozol Catalog Number: |
CBS-FP62307 |
| Supplier Catalog Number: |
FP62307 |
| Alternative Catalog Number: |
CBS-FP62307-0.025KG, CBS-FP62307-0.05KG, CBS-FP62307-0.1KG, CBS-FP62307-0.25KG, CBS-FP62307-0.5KG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
2-Anilinonaphthalene |
| Molecular Weight: |
219.28 g/mol |
| Sequence: |
C1=CC=C(C=C1)NC2=CC3=CC=CC=C3C=C2 |
| CAS Number: |
[135-88-6] |
| Formula: |
C16H13N |