4-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride), CAS [[139301-27-2]]
Catalog Number:
CBS-FT61887
| Article Name: |
4-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride), CAS [[139301-27-2]] |
| Biozol Catalog Number: |
CBS-FT61887 |
| Supplier Catalog Number: |
FT61887 |
| Alternative Catalog Number: |
CBS-FT61887-500G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
4-(Trifluoromethoxy)benzeneboronic Acid (contains varying amounts of Anhydride) |
| Molecular Weight: |
205.93 g/mol |
| Sequence: |
B(C1=CC=C(C=C1)OC(F)(F)F)(O)O |
| CAS Number: |
[139301-27-2] |
| Formula: |
C7H6BF3O3 |