Oripavine - dangerous good and controlled substance, CAS [[467-04-9]]
Catalog Number:
CBS-O-0050
| Article Name: |
Oripavine - dangerous good and controlled substance, CAS [[467-04-9]] |
| Biozol Catalog Number: |
CBS-O-0050 |
| Supplier Catalog Number: |
O-0050 |
| Alternative Catalog Number: |
CBS-O-0050-0.05G, CBS-O-0050-0.1G, CBS-O-0050-0.25G, CBS-O-0050-0.5G, CBS-O-0050-1G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
(5alpha)-6,7,8,14-Tetradehydro-4,5-epoxy-6-methoxy-17-methylmorphinan-3-ol |
| Molecular Weight: |
297.35 g/mol |
| Sequence: |
CN1CCC23C4C(=CC=C2C1CC5=C3C(=C(C=C5)O)O4)OC |
| CAS Number: |
[467-04-9] |
| Formula: |
C18H19NO3 |