Sucrose octabenzoate - Mixture of benzoylated sucrose isomers, CAS [[12738-64-6]]
Catalog Number:
CBS-OS06110
| Article Name: |
Sucrose octabenzoate - Mixture of benzoylated sucrose isomers, CAS [[12738-64-6]] |
| Biozol Catalog Number: |
CBS-OS06110 |
| Supplier Catalog Number: |
OS06110 |
| Alternative Catalog Number: |
CBS-OS06110-100G,CBS-OS06110-250G,CBS-OS06110-500G,CBS-OS06110-1000G |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
Sucrose benzoate |
| Molecular Weight: |
1,175.14 g/mol |
| Sequence: |
O=C(OCC1OC(OC2(COC(=O)c3ccccc3)OC(COC(=O)c4ccccc4)C(OC(=O)c5ccccc5)C2OC(=O)c6ccccc6)C(OC(=O)c7ccccc7)C(OC(=O)c8ccccc8)C1OC(=O)c9ccccc9)c%10ccccc%10 |
| CAS Number: |
[12738-64-6] |
| Formula: |
C68H54O19 |