Lysergic acid methylpropylamide - dangerous good and controlled substance, CAS [[40158-98-3]]
Catalog Number:
CBS-QBA15898
| Article Name: |
Lysergic acid methylpropylamide - dangerous good and controlled substance, CAS [[40158-98-3]] |
| Biozol Catalog Number: |
CBS-QBA15898 |
| Supplier Catalog Number: |
QBA15898 |
| Alternative Catalog Number: |
CBS-QBA15898-10MG, CBS-QBA15898-25MG, CBS-QBA15898-50MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
323.4 g/mol |
| Sequence: |
CCCN(C)C(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C |
| CAS Number: |
[40158-98-3] |
| Formula: |
C20H25N3O |