Propylphenidate hydrochloride, threo, racemic - dangerous good and controlled substance, CAS [[99088-50-3]]
Catalog Number:
CBS-ZDA08850
| Article Name: |
Propylphenidate hydrochloride, threo, racemic - dangerous good and controlled substance, CAS [[99088-50-3]] |
| Biozol Catalog Number: |
CBS-ZDA08850 |
| Supplier Catalog Number: |
ZDA08850 |
| Alternative Catalog Number: |
CBS-ZDA08850-50MG, CBS-ZDA08850-100MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
261.36 g/mol |
| Sequence: |
CCCOC(=O)C(C1CCCCN1)C2=CC=CC=C2 |
| CAS Number: |
[99088-50-3] |
| Formula: |
C16H23NO2 |