1-Propionyl-lysergic acid diethylamide - dangerous good and controlled substance, CAS [[2349358-81-0]]
Catalog Number:
CBS-ZTD35881
| Article Name: |
1-Propionyl-lysergic acid diethylamide - dangerous good and controlled substance, CAS [[2349358-81-0]] |
| Biozol Catalog Number: |
CBS-ZTD35881 |
| Supplier Catalog Number: |
ZTD35881 |
| Alternative Catalog Number: |
CBS-ZTD35881-1MG, CBS-ZTD35881-5MG, CBS-ZTD35881-10MG, CBS-ZTD35881-25MG, CBS-ZTD35881-50MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
379.5 g/mol |
| Sequence: |
CCC(=O)N1C=C2CC3C(=CC(CN3C)C(=O)N(CC)CC)C4=C2C1=CC=C4 |
| CAS Number: |
[2349358-81-0] |
| Formula: |
C23H29N3O2 |