Cythioate, CAS [[115-93-5]]
Catalog Number:
LGC-DRE-C11930000
| Article Name: |
Cythioate, CAS [[115-93-5]] |
| Biozol Catalog Number: |
LGC-DRE-C11930000 |
| Supplier Catalog Number: |
DRE-C11930000 |
| Alternative Catalog Number: |
LGC-DRE-C11930000 |
| Manufacturer: |
Dr. Ehrenstorfer |
| Category: |
Biochemikalien |
| Alternative Names: |
Phosphorothioic acid, O,O-dimethyl O-p-sulfamoylphenyl ester (6CI), Phosphorothioic acid, O,O-dimethyl ester, O-ester with p-hydroxybenzenesulfonamide (7CI,8CI), Benzenesulfonamide, p-hydroxy-, O-ester with O,O-dimethyl phosphorothioate (8CI), CL 26691, Cyflee, Cythioate, ENT 25640, NSC 310287, O,O-Dimethyl O-(4-sulfamoylphenyl) phosphorothioate, O,O-Dimethyl O-(p-sulfamoylphenyl) phosphorothioate, Proban, Proban (pesticide) |
| Molecular Weight: |
297.29 |
| Purity: |
Available |
| Sequence: |
COP(=S)(OC)Oc1ccc(cc1)S(=O)(=O)N |
| CAS Number: |
[115-93-5] |
| Formula: |
C8 H12 N O5 P S2 |
|
DRE-C11930000 |
|
DRE-C11930000 |