Dimethyl 2,6-Dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate (Nitrosophenylpyridine Analogue of Nifedipine), CAS [[50428-14-3]]
Catalog Number:
LGC-MM0003.01-0025
| Article Name: |
Dimethyl 2,6-Dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate (Nitrosophenylpyridine Analogue of Nifedipine), CAS [[50428-14-3]] |
| Biozol Catalog Number: |
LGC-MM0003.01-0025 |
| Supplier Catalog Number: |
MM0003.01-0025 |
| Alternative Catalog Number: |
LGC-MM0003.01-0025 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Dimethyl 2,6-Dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate, Nifedipine Imp. B (EP), Nitrosophenylpyridine Analogue of Nifedipine |
| Molecular Weight: |
328.32 |
| Purity: |
Available |
| Sequence: |
COC(=O)c1c(C)nc(C)c(C(=O)OC)c1c2ccccc2N=O |
| CAS Number: |
[50428-14-3] |
| Formula: |
C17 H16 N2 O5 |
|
MM0003.01-0025 |