Dimethyl 2,6-Dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate (Nitrophenylpyridine Analogue of Nifedipine), CAS [[67035-22-7]]
Catalog Number:
LGC-MM0003.02-0025-4AMP
| Article Name: |
Dimethyl 2,6-Dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate (Nitrophenylpyridine Analogue of Nifedipine), CAS [[67035-22-7]] |
| Biozol Catalog Number: |
LGC-MM0003.02-0025-4AMP |
| Supplier Catalog Number: |
MM0003.02-0025-4AMP |
| Alternative Catalog Number: |
LGC-MM0003.02-0025-4AMP |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(2-nitrophenyl)-, 3,5-dimethyl ester, 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(2-nitrophenyl)-, dimethyl ester (9CI), B 4759, BAY-b 4759, Dehydronifedipine, Dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-3,5-pyridinedicarboxylate, Dimethyl 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate, Nifedipine Imp. A (EP), Nitrophenylpyridine Analogue of Nifedipine, Dehydro Nifedipine |
| Molecular Weight: |
344.32 |
| Purity: |
Available |
| Sequence: |
COC(=O)c1c(C)nc(C)c(C(=O)OC)c1c2ccccc2[N+](=O)[O-] |
| CAS Number: |
[67035-22-7] |
| Formula: |
C17 H16 N2 O6 |
|
MM0003.02-0025-4AMP |