Benperidol N-Oxide (cis and trans), CAS [[118435-01-1]]
Catalog Number:
LGC-MM0113.09
| Article Name: |
Benperidol N-Oxide (cis and trans), CAS [[118435-01-1]] |
| Biozol Catalog Number: |
LGC-MM0113.09 |
| Supplier Catalog Number: |
MM0113.09 |
| Alternative Catalog Number: |
LGC-MM0113.09 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Benperidol N-Oxide (cis and trans), 2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1-oxido-4-piperidinyl]-1,3-dihydro-, 2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1,3-dihydro-, N-oxide |
| Molecular Weight: |
397.44 |
| Purity: |
Available |
| Sequence: |
[O-][N+]1(CCCC(=O)c2ccc(F)cc2)CCC(CC1)N3C(=O)Nc4ccccc34 |
| CAS Number: |
[118435-01-1] |
| Formula: |
C22 H24 F N3 O3 |
![]()
|
MM0113.09 |
![]()
|
MM0113.09 |
