Perazine Dimalonate, CAS [[14777-25-4]]
Catalog Number:
LGC-MM0157.00-0250
| Article Name: |
Perazine Dimalonate, CAS [[14777-25-4]] |
| Biozol Catalog Number: |
LGC-MM0157.00-0250 |
| Supplier Catalog Number: |
MM0157.00-0250 |
| Alternative Catalog Number: |
LGC-MM0157.00-0250 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Perazine Dimalonate, Propanedioic acid compd. with 10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine (2:1), Malonic acid compd. with 10-[3-(4-methyl-1-piperazinyl)propyl]phenothiazine (2:1), 10-[3-(4-Methyl-1-piperazinyl)propyl]-10H-phenothiazine propanedioate (1:2), 10-[3-(4-Methyl-1-piperazinyl)propyl]phenothiazine malonate (1:2), Perazine acid malonate, Perazine dimalonate, Perazine malonate |
| Molecular Weight: |
547.62 |
| Purity: |
Available |
| Sequence: |
CN1CCN(CCCN2c3ccccc3Sc4ccccc24)CC1.OC(=O)CC(=O)O.OC(=O)CC(=O)O |
| CAS Number: |
[14777-25-4] |
| Formula: |
C20 H25 N3 S . 2 C3 H4 O4 |
![]()
|
MM0157.00-0250 |
![]()
|
MM0157.00-0250 |
