Aceclofenac 1,2-Propylene Glycol Esters (Mixture of Isomers)
Catalog Number:
LGC-MM0181.14-0025
| Article Name: |
Aceclofenac 1,2-Propylene Glycol Esters (Mixture of Isomers) |
| Biozol Catalog Number: |
LGC-MM0181.14-0025 |
| Supplier Catalog Number: |
MM0181.14-0025 |
| Alternative Catalog Number: |
LGC-MM0181.14-0025 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Aceclofenac 1,2-Propylene Glycol Ester (Mixture of Isomers) |
| Molecular Weight: |
824.53 |
| Purity: |
Available |
| Sequence: |
CC(O)COC(=O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl.CC(CO)OC(=O)COC(=O)Cc3ccccc3Nc4c(Cl)cccc4Cl |
| Formula: |
2 C19 H19 Cl2 N O5 |
|
MM0181.14-0025 |
|
MM0181.14-0025 |