Isopropyl Ester of Cetirizine, CAS [[324047-27-0]]
Catalog Number:
LGC-MM0380.08
| Article Name: |
Isopropyl Ester of Cetirizine, CAS [[324047-27-0]] |
| Biozol Catalog Number: |
LGC-MM0380.08 |
| Supplier Catalog Number: |
MM0380.08 |
| Alternative Catalog Number: |
LGC-MM0380.08 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
Isopropyl Ester of Cetirizine |
| Molecular Weight: |
430.97 |
| Purity: |
Available |
| Sequence: |
CC(C)OC(=O)COCCN1CCN(CC1)C(c2ccccc2)c3ccc(Cl)cc3 |
| CAS Number: |
[324047-27-0] |
| Formula: |
C24 H31 Cl N2 O3 |
![]()
|
MM0380.08 |
