2-Amino-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-1,7-dihydro-6H-purin-6-one (N-7 Isomer of Ganciclovir), CAS [[84222-50-4]]
Catalog Number:
LGC-MM0485.08-0025
| Article Name: |
2-Amino-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-1,7-dihydro-6H-purin-6-one (N-7 Isomer of Ganciclovir), CAS [[84222-50-4]] |
| Biozol Catalog Number: |
LGC-MM0485.08-0025 |
| Supplier Catalog Number: |
MM0485.08-0025 |
| Alternative Catalog Number: |
LGC-MM0485.08-0025 |
| Manufacturer: |
Mikromol |
| Category: |
Biochemikalien |
| Alternative Names: |
2-Amino-7-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-1,7-dihydro-6H-purin-6-one, Ganciclovir Imp. H (EP), N-7 Isomer of Ganciclovir |
| Molecular Weight: |
255.23 |
| Purity: |
Available |
| Sequence: |
NC1=Nc2ncn(COC(CO)CO)c2C(=O)N1 |
| CAS Number: |
[84222-50-4] |
| Formula: |
C9 H13 N5 O4 |
|
MM0485.08-0025 |
|
MM0485.08-0025 |