FCGRT-B2M Heterodimer, Rat (HEK293, His, Strep II)
Catalog Number:
MCE-HY-P704604
| Article Name: |
FCGRT-B2M Heterodimer, Rat (HEK293, His, Strep II) |
| Biozol Catalog Number: |
MCE-HY-P704604 |
| Supplier Catalog Number: |
HY-P704604 |
| Alternative Catalog Number: |
MCE-HY-P704604-50UG |
| Manufacturer: |
MedchemExpress |
| Category: |
Proteine/Peptide |
| Alternative Names: |
FCGRT-B2M Heterodimer Protein, Rat (HEK293, His, Strep II),Rat,HEK293 |
| Molecular Weight: |
Approximately 43-55 kDa (FCGRT) and 14 kDa (B2M), based on SDS-PAGE under reducing conditions, due to the glycosylation. |
| Formula: |
29558&24223(Gene_ID)P13599 (A23-S298)&P07151(I21-M119)(Accession) |
| Application Notes: |
MCE Product type: Recombinant Proteins |
