BHC, mixture of isomers (a:b:gamma:delta=1:1:1:1) - Dangerous Goods, CAS [[608-73-1]]
Catalog Number:
TOR-B372008
| Article Name: |
BHC, mixture of isomers (a:b:gamma:delta=1:1:1:1) - Dangerous Goods, CAS [[608-73-1]] |
| Biozol Catalog Number: |
TOR-B372008 |
| Supplier Catalog Number: |
B372008 |
| Alternative Catalog Number: |
TOR-B372008-100MG,TOR-B372008-10MG,TOR-B372008-50MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1,2,3,4,5,6-Hexachlorocyclohexane, BHC, HCH, NSC 11807, NSC 7909, NSC 8093, Hexachlorocyclohexane |
| Molecular Weight: |
290.83 |
| Purity: |
>95% (GC) |
| Sequence: |
ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| CAS Number: |
[608-73-1] |
| Formula: |
C6 H6 Cl6 |
![]()
|
B372008 |
![]()
|
B372008 |
