b-(4-Chlorophenoxy)-a-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol(Mixture of Diastereomers) (Triadimenol) - Dangerous Goods, CAS [[55219-65-3]]
Catalog Number:
TOR-C375060
| Article Name: |
b-(4-Chlorophenoxy)-a-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol(Mixture of Diastereomers) (Triadimenol) - Dangerous Goods, CAS [[55219-65-3]] |
| Biozol Catalog Number: |
TOR-C375060 |
| Supplier Catalog Number: |
C375060 |
| Alternative Catalog Number: |
TOR-C375060-10G,TOR-C375060-1G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Bayfidan, Bayfidan EW, Baytan, Baytan 15, Baytan N, Baytan TF 3479B, KWG 0519, Photon 60GR, Shavit, Spinnaker, Triadimenol, UK 199, Vydine, beta-(4-Chlorophenoxy)-alpha-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
| Molecular Weight: |
295.76 |
| Sequence: |
CC(C)(C)C(O)C(Oc1ccc(Cl)cc1)n2cncn2 |
| CAS Number: |
[55219-65-3] |
| Formula: |
C14 H18 Cl N3 O2 |
![]()
|
C375060 |
![]()
|
C375060 |
