trans-Clopidogrel-MP Derivative (Mixture of Diastereomers), CAS [[1287430-40-3]]
Catalog Number:
TOR-C587255
| Article Name: |
trans-Clopidogrel-MP Derivative (Mixture of Diastereomers), CAS [[1287430-40-3]] |
| Biozol Catalog Number: |
TOR-C587255 |
| Supplier Catalog Number: |
C587255 |
| Alternative Catalog Number: |
TOR-C587255-0.5MG,TOR-C587255-5MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Clopidogrel Metabolite II, 3-(carboxymethylene)-alpha-(2-chlorophenyl)-4-[[2-(3-methoxyphenyl)-2-oxoethyl]thio]-1-Piperidineacetic acid 1-methyl ester |
| Molecular Weight: |
504 |
| Sequence: |
ClC1=CC=CC=C1C(C(OC)=O)N2CCC(SCC(C3=CC(OC)=CC=C3)=O)/C(C2)=C/C(O)=O |
| CAS Number: |
[1287430-40-3] |
| Formula: |
C25 H26 Cl N O6 S |
![]()
|
C587255 |
