cis-Clopidogrel-MP Derivative(Pair of Enantiomers)
Catalog Number:
TOR-C587256
| Article Name: |
cis-Clopidogrel-MP Derivative(Pair of Enantiomers) |
| Biozol Catalog Number: |
TOR-C587256 |
| Supplier Catalog Number: |
C587256 |
| Alternative Catalog Number: |
TOR-C587256-10MG,TOR-C587256-1MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
cis-Clopidogrel-MP Derivative (Pair of Enantiomers), cis-Clopidogrel-MP Derivative (Pair of Enantiomers) |
| Molecular Weight: |
504 |
| Purity: |
>95% (HPLC) |
| Sequence: |
COC(=O)C(N1CCC(SCC(=O)c2cccc(OC)c2)\C(=C/C(=O)O)\C1)c3ccccc3Cl |
| Formula: |
C25 H26 Cl N O6 S |
![]()
|
C587256 |
