6,6-Dibromoindigo, CAS [[19201-53-7]] Preis auf Anfrage
Catalog Number:
TOR-D270675
| Article Name: |
6,6-Dibromoindigo, CAS [[19201-53-7]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-D270675 |
| Supplier Catalog Number: |
D270675 |
| Alternative Catalog Number: |
TOR-D270675-500MG,TOR-D270675-1G,TOR-D270675-100MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
(6CI) 6,6-Dibromoindigotin, (7CI,8CI) 6,6-Dibromo[delta2,2-Biindoline]-3,3-dione, 6-Bromo-2-(6-bromo-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one, 6,6-Dibromoindigotin, C.I. 75800, C.I. Natural Violet 1, Murex Purple, Purple of the Ancients, Royal Purple, Tyrian Purple, |
| Molecular Weight: |
420055 |
| Sequence: |
Oc1c([nH]c2cc(Br)ccc12)C3=Nc4cc(Br)ccc4C3=O |
| CAS Number: |
[19201-53-7] |
| Formula: |
C16 H8 Br2 N2 O2 |