Dihydro Ketoprofen (Mixture of Diastereomers), CAS [[59960-32-6]]
Catalog Number:
TOR-D449176
| Article Name: |
Dihydro Ketoprofen (Mixture of Diastereomers), CAS [[59960-32-6]] |
| Biozol Catalog Number: |
TOR-D449176 |
| Supplier Catalog Number: |
D449176 |
| Alternative Catalog Number: |
TOR-D449176-2.5MG,TOR-D449176-25MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2-[3-(alpha-Hydroxybenzyl)phenyl]propanoic Acid |
| Molecular Weight: |
256.3 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CC(C(=O)O)c1cccc(c1)C(O)c2ccccc2 |
| CAS Number: |
[59960-32-6] |
| Formula: |
C16 H16 O3 |
|
D449176 |
|
D449176 |