3,4-Dinitrophenol(wetted with water >15%) - Dangerous Goods, CAS [[577-71-9]]
Catalog Number:
TOR-D480753
| Article Name: |
3,4-Dinitrophenol(wetted with water >15%) - Dangerous Goods, CAS [[577-71-9]] |
| Biozol Catalog Number: |
TOR-D480753 |
| Supplier Catalog Number: |
D480753 |
| Alternative Catalog Number: |
TOR-D480753-250MG,TOR-D480753-500MG,TOR-D480753-50MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
delta-Dinitrophenol, 3,4-DNP |
| Molecular Weight: |
184.11 |
| Purity: |
>95% (HPLC) |
| Sequence: |
Oc1ccc(c(c1)[N+](=O)[O-])[N+](=O)[O-] |
| CAS Number: |
[577-71-9] |
| Formula: |
C6 H4 N2 O5 |
|
D480753 |
|
D480753 |