2,2-(Ethanediyldiimino)bis-butanoic Acid(Mixture of Diastereomers), CAS [[498-17-9]]
Catalog Number:
TOR-E890340
| Article Name: |
2,2-(Ethanediyldiimino)bis-butanoic Acid(Mixture of Diastereomers), CAS [[498-17-9]] |
| Biozol Catalog Number: |
TOR-E890340 |
| Supplier Catalog Number: |
E890340 |
| Alternative Catalog Number: |
TOR-E890340-100MG,TOR-E890340-500MG,TOR-E890340-5G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2,2-(Ethylenediimino)di-butyric Acid, Ethylenediamine-N,N-di-alpha-butyric Acid |
| Molecular Weight: |
232.28 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CCC(NCCNC(CC)C(=O)O)C(=O)O |
| CAS Number: |
[498-17-9] |
| Formula: |
C10 H20 N2 O4 |