5-Ethyl-5-phenyl-2-(1-phenylpropyl)dihydropyrimidine-4,6(1H,5H)-dione (Mixture of Diastereomers), CAS [[1189504-46-8]] Preis auf Anfrage
Catalog Number:
TOR-E925460
| Article Name: |
5-Ethyl-5-phenyl-2-(1-phenylpropyl)dihydropyrimidine-4,6(1H,5H)-dione (Mixture of Diastereomers), CAS [[1189504-46-8]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-E925460 |
| Supplier Catalog Number: |
E925460 |
| Alternative Catalog Number: |
TOR-E925460-10MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Primidone EP Impurity F |
| Molecular Weight: |
336.43 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CCC(C1NC(=O)C(CC)(C(=O)N1)c2ccccc2)c3ccccc3 |
| CAS Number: |
[1189504-46-8] |
| Formula: |
C21 H24 N2 O2 |
![]()
|
E925460 |
![]()
|
E925460 |
