Farnesol (Mixture of Isomers) - Dangerous Goods, CAS [[4602-84-0]]
Catalog Number:
TOR-F102455
| Article Name: |
Farnesol (Mixture of Isomers) - Dangerous Goods, CAS [[4602-84-0]] |
| Biozol Catalog Number: |
TOR-F102455 |
| Supplier Catalog Number: |
F102455 |
| Alternative Catalog Number: |
TOR-F102455-25G,TOR-F102455-50G,TOR-F102455-5G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Farnesol, 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, Farnesol (6CI), 3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol, 3,7,11-Trimethyl-2,6,10-dodecen-1-ol, CSU 1806, FCI 119a, Farnesyl alcohol, NSC 60597, Nikkosome, Farnesol (mixture of isomers) |
| Molecular Weight: |
222.37 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CC(=CCCC(=CCCC(=CCO)C)C)C |
| CAS Number: |
[4602-84-0] |
| Formula: |
C15 H26 O |
![]()
|
F102455 |
![]()
|
F102455 |
