Furfural-d4 (Stabilized with BHT) - Dangerous Goods, CAS [[1219803-80-1]]
Catalog Number:
TOR-F864172
| Article Name: |
Furfural-d4 (Stabilized with BHT) - Dangerous Goods, CAS [[1219803-80-1]] |
| Biozol Catalog Number: |
TOR-F864172 |
| Supplier Catalog Number: |
F864172 |
| Alternative Catalog Number: |
TOR-F864172-250MG,TOR-F864172-25MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2-Furan-3,4,5-d3-carboxaldehyde-d (ACI), Furfural-d4, Furfural-D4, 2-Furancarboxaldehyde-d4, 2-Furaldehyde-d4, 2-Furanal-d4, Furane-2-carbaldehyde-d4, Furfuraldehyde-d4 |
| Molecular Weight: |
100.11 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
[2H]C(=O)c1oc([2H])c([2H])c1[2H] |
| CAS Number: |
[1219803-80-1] |
| Formula: |
C5 2H4 O2 |
![]()
|
F864172 |
