rac Galaxolidone (Mixture of Diastereomers) - Dangerous Goods, CAS [[507442-49-1]]
Catalog Number:
TOR-G189005
| Article Name: |
rac Galaxolidone (Mixture of Diastereomers) - Dangerous Goods, CAS [[507442-49-1]] |
| Biozol Catalog Number: |
TOR-G189005 |
| Supplier Catalog Number: |
G189005 |
| Alternative Catalog Number: |
TOR-G189005-25MG,TOR-G189005-50MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
4,6,7,8-Tetrahydro-4,6,6,7,8,8-hexamethyl-cyclopenta[g]-2-benzopyran-1(3H)-one |
| Molecular Weight: |
272.38 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
O=C1OCC(C)C2=CC3=C(C(C)(C)C(C)C3(C)C)C=C21 |
| CAS Number: |
[507442-49-1] |
| Formula: |
C18H24O2 |
![]()
|
G189005 |
