rac Galaxolidone-d6 (Mixture of Diastereomers) - Dangerous Goods
Catalog Number:
TOR-G189007
| Article Name: |
rac Galaxolidone-d6 (Mixture of Diastereomers) - Dangerous Goods |
| Biozol Catalog Number: |
TOR-G189007 |
| Supplier Catalog Number: |
G189007 |
| Alternative Catalog Number: |
TOR-G189007-10MG,TOR-G189007-1MG,TOR-G189007-25MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
4,6,7,8-Tetrahydro-4,6,6,7,8,8-hexamethyl-cyclopenta[g]-2-benzopyran-1(3H)-one-d6 |
| Molecular Weight: |
278.42 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
[2H]C([2H])([2H])C1([2H])c2cc3c(cc2C(=O)OC1([2H])[2H])C(C)(C)C(C)C3(C)C |
| Formula: |
C18 D6 H18 O2 |
|
TRC Logo |