4-{1-Hydroxy-2-[3-(4-hydroxyphenyl)-5-methylcyclohexylamino]ethyl}phenol Hydrochloride (Mixture of Diastereomers) Preis auf Anfrage
Catalog Number:
TOR-H825390
| Article Name: |
4-{1-Hydroxy-2-[3-(4-hydroxyphenyl)-5-methylcyclohexylamino]ethyl}phenol Hydrochloride (Mixture of Diastereomers) Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-H825390 |
| Supplier Catalog Number: |
H825390 |
| Alternative Catalog Number: |
TOR-H825390-10MG,TOR-H825390-1MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Molecular Weight: |
377.9 |
| Form: |
Neat |
| Sequence: |
Cl.CC1CC(CC(C1)c2ccc(O)cc2)NCC(O)c3ccc(O)cc3 |
| Formula: |
C21 H27 N O3 . H Cl |
|
TRC Logo |