4-Hydroxy Loxoprofen Alcohol (Mixture of Diastereomers), CAS [[88378-22-7]] Preis auf Anfrage
Catalog Number:
TOR-H825570
| Article Name: |
4-Hydroxy Loxoprofen Alcohol (Mixture of Diastereomers), CAS [[88378-22-7]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-H825570 |
| Supplier Catalog Number: |
H825570 |
| Alternative Catalog Number: |
TOR-H825570-1UNIT |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2-(4-((2,4-Dihydroxycyclopentyl)methyl)phenyl)propanoic Acid, 4-[(2,4-Dihydroxycyclopentyl)methyl]-alpha-methylbenzeneacetic Acid, |
| Molecular Weight: |
264317 |
| Sequence: |
CC(C(=O)O)c1ccc(CC2CC(O)CC2O)cc1 |
| CAS Number: |
[88378-22-7] |
| Formula: |
C15 H20 O4 |
![]()
|
H825570 |
