1-Hydroxy Bufuralol (Mixture of Diastereomers), CAS [[57704-16-2]]
Catalog Number:
TOR-H830480
| Article Name: |
1-Hydroxy Bufuralol (Mixture of Diastereomers), CAS [[57704-16-2]] |
| Biozol Catalog Number: |
TOR-H830480 |
| Supplier Catalog Number: |
H830480 |
| Alternative Catalog Number: |
TOR-H830480-10MG,TOR-H830480-1MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1-Hydroxy Bufuralol (Mixture Of Diastereomers) |
| Molecular Weight: |
277.36 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
CC(O)c1cccc2cc(oc12)C(O)CNC(C)(C)C |
| CAS Number: |
[57704-16-2] |
| Formula: |
C16 H23 N O3 |