1-Hydroxy Ibuprofen (Ibuprofen Impurity L) (Mixture of Diastereomers), CAS [[53949-53-4]]
Catalog Number:
TOR-H942858
| Article Name: |
1-Hydroxy Ibuprofen (Ibuprofen Impurity L) (Mixture of Diastereomers), CAS [[53949-53-4]] |
| Biozol Catalog Number: |
TOR-H942858 |
| Supplier Catalog Number: |
H942858 |
| Alternative Catalog Number: |
TOR-H942858-25MG,TOR-H942858-50MG,TOR-H942858-5MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Benzeneacetic acid, 4-(1-hydroxy-2-methylpropyl)-alpha-methyl-, 1-Hydroxyibuprofen, 4-(1-Hydroxy-2-methylpropyl)-alpha-methylbenzeneacetic acid, 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propionic acid |
| Molecular Weight: |
222.28 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CC(C)C(O)c1ccc(cc1)C(C)C(=O)O |
| CAS Number: |
[53949-53-4] |
| Formula: |
C13 H18 O3 |
![]()
|
H942858 |
![]()
|
H942858 |
