Ibuprofen Carboxylic Acid(Mixture of Diastereomers), CAS [[15935-54-3]]
Catalog Number:
TOR-I140015
| Article Name: |
Ibuprofen Carboxylic Acid(Mixture of Diastereomers), CAS [[15935-54-3]] |
| Biozol Catalog Number: |
TOR-I140015 |
| Supplier Catalog Number: |
I140015 |
| Alternative Catalog Number: |
TOR-I140015-10MG,TOR-I140015-2.5MG,TOR-I140015-25MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Benzenepropanoic acid, 4-(1-carboxyethyl)-alpha-methyl- (9CI), 2,4-(2-Carboxypropyl)phenylpropionic acid, 2-[4-(2-Carboxypropyl)phenyl]propionic acid, 4-(2-Carboxypropyl)-alpha-methylbenzeneacetic acid, Carboxyibuprofen, Ibuprofen COOH, 3-[4-(1-Carboxyethyl)phenyl]-2-methylpropanoic acid, 2-Carboxyibuprofen |
| Molecular Weight: |
236.26 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
CC(Cc1ccc(cc1)C(C)C(=O)O)C(=O)O |
| CAS Number: |
[15935-54-3] |
| Formula: |
C13 H16 O4 |
![]()
|
I140015 |
![]()
|
I140015 |
