Lotaustralin (Mixture of Diastereomers) Preis auf Anfrage
Catalog Number:
TOR-L471255
| Article Name: |
Lotaustralin (Mixture of Diastereomers) Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-L471255 |
| Supplier Catalog Number: |
L471255 |
| Alternative Catalog Number: |
TOR-L471255-1UNIT |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2-(beta-D-Glucopyranosyloxy)-2-methylbutyronitrile, 2-(beta-D-Glucopyranosyloxy)-2-methyl-butanenitrile |
| Molecular Weight: |
261.27 |
| Form: |
Neat |
| Sequence: |
NCC(OC1OC(CO)C(O)C(O)C1O)(C)CC |
| CAS Number: |
[534-67-8] |
| Formula: |
C11 H19 N O6 |
|
L471255 |
|
L471255 |