1,1-[(1-Methylethyl)imino]bis[3-[4-(2-methoxyethyl)phenoxy]-2-propanol(Mixture of Diastereomers), CAS [[154784-36-8]] Preis auf Anfrage
Catalog Number:
TOR-M304900
| Article Name: |
1,1-[(1-Methylethyl)imino]bis[3-[4-(2-methoxyethyl)phenoxy]-2-propanol(Mixture of Diastereomers), CAS [[154784-36-8]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-M304900 |
| Supplier Catalog Number: |
M304900 |
| Alternative Catalog Number: |
TOR-M304900-100MG,TOR-M304900-10MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1,1-[(1-Methylethyl)imino]bis-[3-[4-(2-methoxyethyl)phenoxy]propan-2-ol], Metoprolol Succinate Imp. O (EP), Metoprolol Tartrate Imp. O (EP) |
| Molecular Weight: |
475.62 |
| Purity: |
>95% (HPLC) |
| Sequence: |
COCCc1ccc(OCC(O)CN(CC(O)COc2ccc(CCOC)cc2)C(C)C)cc1 |
| CAS Number: |
[154784-36-8] |
| Formula: |
C27 H41 N O6 |
![]()
|
M304900 |
![]()
|
M304900 |
