Metoprolol Succinate, CAS [[98418-47-4]]
Catalog Number:
TOR-M338825
| Article Name: |
Metoprolol Succinate, CAS [[98418-47-4]] |
| Biozol Catalog Number: |
TOR-M338825 |
| Supplier Catalog Number: |
M338825 |
| Alternative Catalog Number: |
TOR-M338825-100MG,TOR-M338825-1G,TOR-M338825-5G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Metoprolol Succinate, Butanedioic acid compd. with 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol (1:2), Butanedioic acid compd. with ()-1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol (1:2), ()-1-[4-(2-Methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol butanedioate (2:1) (salt), 1-[4-(2-Methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol butanedioate (2:1) (salt), Beloc-Zok, Betaloc CR, Betaloc Zok, Betazok, H 93/26 succinate, Metoprolol succinate, Seloken-Zok, Selozok, Toprol XL |
| Molecular Weight: |
652.82 |
| Purity: |
>95% (HPLC) |
| Sequence: |
COCCc1ccc(OCC(O)CNC(C)C)cc1.COCCc2ccc(OCC(O)CNC(C)C)cc2.OC(=O)CCC(=O)O |
| CAS Number: |
[98418-47-4] |
| Formula: |
2 C15 H25 N O3 . C4 H6 O4 |
|
M338825 |
|
M338825 |