Propafenone Dimer Impurity (Mixture of Diastereomers), CAS [[1346603-80-2]]
Catalog Number:
TOR-P757520
| Article Name: |
Propafenone Dimer Impurity (Mixture of Diastereomers), CAS [[1346603-80-2]] |
| Biozol Catalog Number: |
TOR-P757520 |
| Supplier Catalog Number: |
P757520 |
| Alternative Catalog Number: |
TOR-P757520-50MG,TOR-P757520-5MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1,1-[Propyliminobis[(2-hydroxypropane-3,1-diyl)oxy-2,1-phenylene]]bis(3-phenylpropan-1-one), Propafenone Imp. G (EP), 1-[2-[2-Hydroxy-3-[[2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-propylamino]propoxy]phenyl]-3-phenylpropan-1-one |
| Molecular Weight: |
623.78 |
| Purity: |
>95% (HPLC) |
| Sequence: |
CCCN(CC(O)COc1ccccc1C(=O)CCc2ccccc2)CC(O)COc3ccccc3C(=O)CCc4ccccc4 |
| CAS Number: |
[1346603-80-2] |
| Formula: |
C39H45NO6 |
![]()
|
P757520 |
![]()
|
P757520 |
