tert-Dodecanethiol (Mixture of Isomers), CAS [[25103-58-6]]
Catalog Number:
TOR-T204763
| Article Name: |
tert-Dodecanethiol (Mixture of Isomers), CAS [[25103-58-6]] |
| Biozol Catalog Number: |
TOR-T204763 |
| Supplier Catalog Number: |
T204763 |
| Alternative Catalog Number: |
TOR-T204763-1G,TOR-T204763-500MG,TOR-T204763-5G |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Sulfole 120, TDM, t-DDM, tert-Dodecyl Thiol, tert-Lauryl Mercaptan |
| Molecular Weight: |
202.4 |
| Form: |
Neat |
| Sequence: |
CC(C)(C)CC(C)(S)CC(C)(C)C |
| CAS Number: |
[25103-58-6] |
| Formula: |
C12 H26 S |
|
T204763 |
|
T204763 |