N,N,N-Tributyl-1-butanaminium Salt with (E)-3-Hydroxy-2-propenal - Dangerous Goods, CAS [[100683-54-3]]
Catalog Number:
TOR-T773768
| Article Name: |
N,N,N-Tributyl-1-butanaminium Salt with (E)-3-Hydroxy-2-propenal - Dangerous Goods, CAS [[100683-54-3]] |
| Biozol Catalog Number: |
TOR-T773768 |
| Supplier Catalog Number: |
T773768 |
| Alternative Catalog Number: |
TOR-T773768-100MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
Malondialdehyde Tetrabutylammonium Salt |
| Molecular Weight: |
313.5 |
| Purity: |
>95% (HPLC) |
| Form: |
Neat |
| Sequence: |
CCCC[N+](CCCC)(CCCC)CCCC.[O-]\C=C\C=O |
| CAS Number: |
[100683-54-3] |
| Formula: |
C19H39NO2 |
![]()
|
T773768 |
