3-Hydroxy-3-O-methoxymethyl Repaglinide Ethyl Ester(Mixture of Diastereomers), CAS [[1276362-58-3]]
Catalog Number:
TOR-TRC-H946335
| Article Name: |
3-Hydroxy-3-O-methoxymethyl Repaglinide Ethyl Ester(Mixture of Diastereomers), CAS [[1276362-58-3]] |
| Biozol Catalog Number: |
TOR-TRC-H946335 |
| Supplier Catalog Number: |
TRC-H946335 |
| Alternative Catalog Number: |
TOR-TRC-H946335-10MG, TOR-TRC-H946335-1MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-3-O-methoxymethyl-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic Acid Ethyl Ester, |
| Molecular Weight: |
540.69 |
| Sequence: |
O=C(CC1=CC(OCC)=C(C(OCC)=O)C=C1)NC(CC(C)C)C2=C(N3CC(OCOC)CCC3)C=CC=C2 |
| CAS Number: |
[1276362-58-3] |
| Formula: |
C31H44N2O6 |